Products 1183846-39-0
CAS 1183846-39-0 is the registry number for 4-Bromo-N-((4-methylthiazol-2-yl)methyl)-1H-pyrrole-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1H-pyrrole-2-carboxamide (CAS 1183846-39-0) is a chemical compound with the molecular formula C10H10BrN3OS and a molecular weight of 300.18 g/mol. IUPAC name: 4-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1H-pyrrole-2-carboxamide. InChIKey: JOBBYWMDKYGCAZ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3OS |
|---|---|
| Molecular weight | 300.18 g/mol |
| IUPAC name | 4-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1H-pyrrole-2-carboxamide |
| InChIKey | JOBBYWMDKYGCAZ-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)CNC(=O)C2=CC(=CN2)Br |
Computed by PubChem (NCBI)