CAS 1183904-30-4 is the registry number for 4-(2-Methanesulfonylethoxy)aniline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(2-methylsulfonylethoxy)aniline (CAS 1183904-30-4) is a chemical compound with the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. IUPAC name: 4-(2-methylsulfonylethoxy)aniline. InChIKey: BXIVECHCOYZFBT-UHFFFAOYSA-N.
| Molecular formula | C9H13NO3S |
|---|---|
| Molecular weight | 215.27 g/mol |
| IUPAC name | 4-(2-methylsulfonylethoxy)aniline |
| InChIKey | BXIVECHCOYZFBT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CCOC1=CC=C(C=C1)N |
Computed by PubChem (NCBI)