Products 1183911-09-2
CAS 1183911-09-2 appears in our catalog under these names: tert-Butyl 3-amino-4-fluorobenzoate, 95%, tert-Butyl 3-amino-4-fluorobenzoate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Tert-butyl 3-amino-4-fluorobenzoate (CAS 1183911-09-2) is a chemical compound with the molecular formula C11H14FNO2 and a molecular weight of 211.23 g/mol. IUPAC name: tert-butyl 3-amino-4-fluorobenzoate. InChIKey: GULUDWNZCILTJQ-UHFFFAOYSA-N.
| Molecular formula | C11H14FNO2 |
|---|---|
| Molecular weight | 211.23 g/mol |
| IUPAC name | tert-butyl 3-amino-4-fluorobenzoate |
| InChIKey | GULUDWNZCILTJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C=C1)F)N |
Computed by PubChem (NCBI)