CAS 1184107-87-6 appears in our catalog under these names: {(4-bromo-2-(trifluoromethyl)phenyl)carbamoyl}formic acid, 95%, {(4-Bromo-2-(trifluoromethyl)phenyl)carbamoyl}formic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoacetic acid (CAS 1184107-87-6) is a chemical compound with the molecular formula C9H5BrF3NO3 and a molecular weight of 312.04 g/mol. IUPAC name: 2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoacetic acid. InChIKey: VDDIGBZRXATBOE-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF3NO3 |
|---|---|
| Molecular weight | 312.04 g/mol |
| IUPAC name | 2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoacetic acid |
| InChIKey | VDDIGBZRXATBOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(F)(F)F)NC(=O)C(=O)O |
Computed by PubChem (NCBI)