Products 1184120-37-3

CAS 1184120-37-3 is the registry number for 3-(N-Ethyl-2-(4-oxothiazolidin-3-yl)acetamido)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[ethyl-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]propanoic acid (CAS 1184120-37-3) is a chemical compound with the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. IUPAC name: 3-[ethyl-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]propanoic acid. InChIKey: NNEDHHXLGMARFN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16N2O4S
Molecular weight260.31 g/mol
IUPAC name3-[ethyl-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]propanoic acid
InChIKeyNNEDHHXLGMARFN-UHFFFAOYSA-N
SMILESCCN(CCC(=O)O)C(=O)CN1CSCC1=O

Computed by PubChem (NCBI)