CAS 118435-03-3 appears in our catalog under these names: Domperidone Impurity 3(Domperidone EP Impurity C), Domperidone Impurity C, Domperidone N-Oxide, rac-Domperidone EP Impurity C (Domperidone N-Oxide), Domperidone N-Oxide, >95% (HPLC). Offered by: Hubei YoungXin, Chemat Brand, Mikromol, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 0,05g, 0,025g.
6-chloro-3-[1-oxido-1-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]piperidin-1-ium-4-yl]-1H-benzimidazol-2-one (CAS 118435-03-3) is a chemical compound with the molecular formula C22H24ClN5O3 and a molecular weight of 441.9 g/mol. IUPAC name: 6-chloro-3-[1-oxido-1-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]piperidin-1-ium-4-yl]-1H-benzimidazol-2-one. InChIKey: HZXNVTGQTMNCFN-UHFFFAOYSA-N.
| Molecular formula | C22H24ClN5O3 |
|---|---|
| Molecular weight | 441.9 g/mol |
| IUPAC name | 6-chloro-3-[1-oxido-1-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]piperidin-1-ium-4-yl]-1H-benzimidazol-2-one |
| InChIKey | HZXNVTGQTMNCFN-UHFFFAOYSA-N |
| SMILES | C1C[N+](CCC1N2C3=C(C=C(C=C3)Cl)NC2=O)(CCCN4C5=CC=CC=C5NC4=O)[O-] |
Computed by PubChem (NCBI)