Products 1184620-01-6
CAS 1184620-01-6 appears in our catalog under these names: 3-(4-bromophenyl)-5-chloro-1,2,4-oxadiazole, 95%, 3-(4-bromophenyl)-5-chloro-1,2,4-oxadiazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 100mg, 5g, 250mg, 0,5g, 50mg.
3-(4-bromophenyl)-5-chloro-1,2,4-oxadiazole (CAS 1184620-01-6) is a chemical compound with the molecular formula C8H4BrClN2O and a molecular weight of 259.49 g/mol. IUPAC name: 3-(4-bromophenyl)-5-chloro-1,2,4-oxadiazole. InChIKey: FMPZVWXNFOKUER-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClN2O |
|---|---|
| Molecular weight | 259.49 g/mol |
| IUPAC name | 3-(4-bromophenyl)-5-chloro-1,2,4-oxadiazole |
| InChIKey | FMPZVWXNFOKUER-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)Cl)Br |
Computed by PubChem (NCBI)