CAS 1204652-85-6 appears in our catalog under these names: 3-Bromo-7-chloro-1,4-dihydrocinnolin-4-one, 95%, 3-Bromo-7-chloro-cinnolin-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
3-bromo-7-chloro-1H-cinnolin-4-one (CAS 1204652-85-6) is a chemical compound with the molecular formula C8H4BrClN2O and a molecular weight of 259.49 g/mol. IUPAC name: 3-bromo-7-chloro-1H-cinnolin-4-one. InChIKey: XSIDVQGYSQNTFV-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClN2O |
|---|---|
| Molecular weight | 259.49 g/mol |
| IUPAC name | 3-bromo-7-chloro-1H-cinnolin-4-one |
| InChIKey | XSIDVQGYSQNTFV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NN=C(C2=O)Br |
Computed by PubChem (NCBI)