CAS 1184668-88-9 appears in our catalog under these names: 4-Methanesulfonamido-3-nitrobenzoic acid, 98%, 4-Methanesulfonamido-3-nitrobenzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g.
4-(methanesulfonamido)-3-nitrobenzoic acid (CAS 1184668-88-9) is a chemical compound with the molecular formula C8H8N2O6S and a molecular weight of 260.23 g/mol. IUPAC name: 4-(methanesulfonamido)-3-nitrobenzoic acid. InChIKey: KPMVBNPWPBLWHZ-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O6S |
|---|---|
| Molecular weight | 260.23 g/mol |
| IUPAC name | 4-(methanesulfonamido)-3-nitrobenzoic acid |
| InChIKey | KPMVBNPWPBLWHZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)