CAS 1184847-16-2 is the registry number for JNJ-40413269. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R)-2-[[6-[3-chloro-4-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]-1-phenylethanol (CAS 1184847-16-2) is a chemical compound with the molecular formula C19H15ClF3N3O and a molecular weight of 393.8 g/mol. IUPAC name: (1R)-2-[[6-[3-chloro-4-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]-1-phenylethanol. InChIKey: MDJZLXVNWZQKAO-KRWDZBQOSA-N.
| Molecular formula | C19H15ClF3N3O |
|---|---|
| Molecular weight | 393.8 g/mol |
| IUPAC name | (1R)-2-[[6-[3-chloro-4-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]-1-phenylethanol |
| InChIKey | MDJZLXVNWZQKAO-KRWDZBQOSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CNC2=NC=NC(=C2)C3=CC(=C(C=C3)C(F)(F)F)Cl)O |
Computed by PubChem (NCBI)