CAS 1184913-85-6 is the registry number for 4,6-Dichloro-1-(3-methoxybenzyl)-1h-pyrazolo[3,4-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4,6-dichloro-1-[(3-methoxyphenyl)methyl]pyrazolo[5,4-d]pyrimidine (CAS 1184913-85-6) is a chemical compound with the molecular formula C13H10Cl2N4O and a molecular weight of 309.15 g/mol. IUPAC name: 4,6-dichloro-1-[(3-methoxyphenyl)methyl]pyrazolo[5,4-d]pyrimidine. InChIKey: XIPXHFGQISZWCO-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2N4O |
|---|---|
| Molecular weight | 309.15 g/mol |
| IUPAC name | 4,6-dichloro-1-[(3-methoxyphenyl)methyl]pyrazolo[5,4-d]pyrimidine |
| InChIKey | XIPXHFGQISZWCO-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)CN2C3=C(C=N2)C(=NC(=N3)Cl)Cl |
Computed by PubChem (NCBI)