CAS 1184916-06-0 is the registry number for 2-Amino-6-bromo-8-isopropyl-4-methylpteridin-7(8h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-amino-6-bromo-4-methyl-8-propan-2-ylpteridin-7-one (CAS 1184916-06-0) is a chemical compound with the molecular formula C10H12BrN5O and a molecular weight of 298.14 g/mol. IUPAC name: 2-amino-6-bromo-4-methyl-8-propan-2-ylpteridin-7-one. InChIKey: KSEXJWDVOBFVRY-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN5O |
|---|---|
| Molecular weight | 298.14 g/mol |
| IUPAC name | 2-amino-6-bromo-4-methyl-8-propan-2-ylpteridin-7-one |
| InChIKey | KSEXJWDVOBFVRY-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NC(=N1)N)N(C(=O)C(=N2)Br)C(C)C |
Computed by PubChem (NCBI)