CAS 1184973-36-1 is the registry number for 5-Methyl-5-propyl-2-dioxanone-d3. Offered by: TRC. Available pack sizes: 100mg, 10mg.
5-propyl-5-(trideuteriomethyl)-1,3-dioxan-2-one (CAS 1184973-36-1) is a chemical compound with the molecular formula C8H14O3 and a molecular weight of 161.21 g/mol. IUPAC name: 5-propyl-5-(trideuteriomethyl)-1,3-dioxan-2-one. InChIKey: QPAWSFWKAUAJKW-BMSJAHLVSA-N.
| Molecular formula | C8H14O3 |
|---|---|
| Molecular weight | 161.21 g/mol |
| IUPAC name | 5-propyl-5-(trideuteriomethyl)-1,3-dioxan-2-one |
| InChIKey | QPAWSFWKAUAJKW-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])C1(COC(=O)OC1)CCC |
Computed by PubChem (NCBI)