Products 1184980-42-4
CAS 1184980-42-4 appears in our catalog under these names: Phenazepam-d5, Phenazepam–d4 (CRM), Phenazepam-d4. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
7-bromo-5-(2-chloro-3,4,5,6-tetradeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 1184980-42-4) is a chemical compound with the molecular formula C15H10BrClN2O and a molecular weight of 353.63 g/mol. IUPAC name: 7-bromo-5-(2-chloro-3,4,5,6-tetradeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: CGMJQQJSWIRRRL-RHQRLBAQSA-N.
| Molecular formula | C15H10BrClN2O |
|---|---|
| Molecular weight | 353.63 g/mol |
| IUPAC name | 7-bromo-5-(2-chloro-3,4,5,6-tetradeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | CGMJQQJSWIRRRL-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C2=NCC(=O)NC3=C2C=C(C=C3)Br)Cl)[2H])[2H] |
Computed by PubChem (NCBI)