CAS 1184986-70-6 appears in our catalog under these names: 5,7–Dichlorokynurenic acid sodium salt, 5,7-Dichlorokynurenic acid sodium salt, 5,7-Dichlorokynurenic acid (sodium). Offered by: GLPBio, TargetMol, MedChemExpress. Available pack sizes: 10mg, 50mg, Get quote.
Sodium 5,7-dichloro-4-oxo-1H-quinoline-2-carboxylate (CAS 1184986-70-6) is a chemical compound with the molecular formula C10H4Cl2NNaO3 and a molecular weight of 280.04 g/mol. IUPAC name: sodium 5,7-dichloro-4-oxo-1H-quinoline-2-carboxylate. InChIKey: VPRPMJHKWHCUFW-UHFFFAOYSA-M.
| Molecular formula | C10H4Cl2NNaO3 |
|---|---|
| Molecular weight | 280.04 g/mol |
| IUPAC name | sodium 5,7-dichloro-4-oxo-1H-quinoline-2-carboxylate |
| InChIKey | VPRPMJHKWHCUFW-UHFFFAOYSA-M |
| SMILES | C1=C(C=C(C2=C1NC(=CC2=O)C(=O)[O-])Cl)Cl.[Na+] |
Computed by PubChem (NCBI)