CAS 1184991-15-8 appears in our catalog under these names: Sodium 3-oxo-2-propylpentanoate, 98%, 3-Keto Valproic Acid Sodium Salt. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 25mg.
Sodium 3-oxo-2-propylpentanoate (CAS 1184991-15-8) is a chemical compound with the molecular formula C8H13NaO3 and a molecular weight of 180.18 g/mol. IUPAC name: sodium 3-oxo-2-propylpentanoate. InChIKey: ZYNHUWISZOLICF-UHFFFAOYSA-M.
| Molecular formula | C8H13NaO3 |
|---|---|
| Molecular weight | 180.18 g/mol |
| IUPAC name | sodium 3-oxo-2-propylpentanoate |
| InChIKey | ZYNHUWISZOLICF-UHFFFAOYSA-M |
| SMILES | CCCC(C(=O)CC)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)