Products 1185003-07-9
CAS 1185003-07-9 is the registry number for Fludioxonil-13C3. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(2,2-difluoro-1,3-benzodioxol-4-yl)-(3,4-13C2)1H-pyrrole-3-carbonitrile (CAS 1185003-07-9) is a chemical compound with the molecular formula C12H6F2N2O2 and a molecular weight of 251.16 g/mol. IUPAC name: 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-(3,4-13C2)1H-pyrrole-3-carbonitrile. InChIKey: MUJOIMFVNIBMKC-XWKFXZGISA-N.
| Molecular formula | C12H6F2N2O2 |
|---|---|
| Molecular weight | 251.16 g/mol |
| IUPAC name | 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-(3,4-13C2)1H-pyrrole-3-carbonitrile |
| InChIKey | MUJOIMFVNIBMKC-XWKFXZGISA-N |
| SMILES | C1=CC(=C2C(=C1)OC(O2)(F)F)[13C]3=CNC=[13C]3[13C]#N |
Computed by PubChem (NCBI)