CAS 1185023-23-7 appears in our catalog under these names: 2-Methyl-d3-2-propyl-1,3-propanediol, 2-Methyl-d3-2-propyl-1,3-propanediol, 99 atom % D, min 98% Chemical Purity, 2-Methyl-2-propylpropane-1,3-diol-d3, 98.8%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,25g, 0,1g, 25 mg, 5 mg, 10 mg, 50 mg.
2-propyl-2-(trideuteriomethyl)propane-1,3-diol (CAS 1185023-23-7) is a chemical compound with the molecular formula C7H16O2 and a molecular weight of 135.22 g/mol. IUPAC name: 2-propyl-2-(trideuteriomethyl)propane-1,3-diol. InChIKey: JVZZUPJFERSVRN-BMSJAHLVSA-N.
| Molecular formula | C7H16O2 |
|---|---|
| Molecular weight | 135.22 g/mol |
| IUPAC name | 2-propyl-2-(trideuteriomethyl)propane-1,3-diol |
| InChIKey | JVZZUPJFERSVRN-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])C(CCC)(CO)CO |
Computed by PubChem (NCBI)