CAS 1185023-32-8 appears in our catalog under these names: [2-(3-Benzyl-1h-1,2,4-triazol-5-yl)ethyl]amine hydrochloride, 95%, 3-(Phenylmethyl)-1H-1,2,4-triazole-5-ethanamine Hydrochloride, 2-(3-Benzyl-1H-1,2,4-triazol-5-yl)ethanamine hydrochloride, 97%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 250mg, 1g.
2-(5-benzyl-1H-1,2,4-triazol-3-yl)ethanamine;hydrochloride (CAS 1185023-32-8) is a chemical compound with the molecular formula C11H15ClN4 and a molecular weight of 238.72 g/mol. IUPAC name: 2-(5-benzyl-1H-1,2,4-triazol-3-yl)ethanamine;hydrochloride. InChIKey: OYMZVDTWQDCGJI-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN4 |
|---|---|
| Molecular weight | 238.72 g/mol |
| IUPAC name | 2-(5-benzyl-1H-1,2,4-triazol-3-yl)ethanamine;hydrochloride |
| InChIKey | OYMZVDTWQDCGJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=NN2)CCN.Cl |
Computed by PubChem (NCBI)