Products 1185031-19-9
CAS 1185031-19-9 appears in our catalog under these names: Pindolol-d7, Pindolol-d7, >95% (HPLC), (±)-Pindolol-d7 (iso-propyl-d7), 99 atom % D, min 98% Chemical Purity. Offered by: Chemat Brand, TRC, CDN, MedChemExpress. Available pack sizes: on request, 1mg, 2,5mg, 0,01g, 0,005g, 1 mg, 10 mg, 5 mg.
1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-(1H-indol-4-yloxy)propan-2-ol (CAS 1185031-19-9) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 255.36 g/mol. IUPAC name: 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-(1H-indol-4-yloxy)propan-2-ol. InChIKey: JZQKKSLKJUAGIC-SVMCCORHSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 255.36 g/mol |
| IUPAC name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-(1H-indol-4-yloxy)propan-2-ol |
| InChIKey | JZQKKSLKJUAGIC-SVMCCORHSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=CC2=C1C=CN2)O |
Computed by PubChem (NCBI)