Products 1185039-30-8
CAS 1185039-30-8 appears in our catalog under these names: Gliclazide D4, Gliclazide-d4, Gliclazide-d4, >95% (HPLC), Gliclazide-d4 (phenyl-d4), 99 atom % D, min 98% Chemical Purity, Gliclazide–d4. Offered by: Chemat Brand, TRC, CDN, GLPBio, TargetMol. Available pack sizes: on request, 10mg, 1mg, 5mg, 0,01g, 0,005g, 5 mg, 1 mg.
1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3-(2,3,5,6-tetradeuterio-4-methylphenyl)sulfonylurea (CAS 1185039-30-8) is a chemical compound with the molecular formula C15H21N3O3S and a molecular weight of 327.4 g/mol. IUPAC name: 1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3-(2,3,5,6-tetradeuterio-4-methylphenyl)sulfonylurea. InChIKey: BOVGTQGAOIONJV-KDWZCNHSSA-N.
| Molecular formula | C15H21N3O3S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3-(2,3,5,6-tetradeuterio-4-methylphenyl)sulfonylurea |
| InChIKey | BOVGTQGAOIONJV-KDWZCNHSSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C)[2H])[2H])S(=O)(=O)NC(=O)NN2CC3CCCC3C2)[2H] |
Computed by PubChem (NCBI)