CAS 1185040-73-6 is the registry number for 3-(((2-((Diaminomethylene)amino-4-thiazolyl)thio)propionitrile-13C3. Offered by: TRC. Available pack sizes: 50mg.
2-[4-(2-cyanoethylsulfanylmethyl)-(2,4-13C2)1,3-thiazol-2-yl](13C)guanidine (CAS 1185040-73-6) is a chemical compound with the molecular formula C8H11N5S2 and a molecular weight of 244.3 g/mol. IUPAC name: 2-[4-(2-cyanoethylsulfanylmethyl)-(2,4-13C2)1,3-thiazol-2-yl](13C)guanidine. InChIKey: FSKYYRZENXOYAP-TTXLGWKISA-N.
| Molecular formula | C8H11N5S2 |
|---|---|
| Molecular weight | 244.3 g/mol |
| IUPAC name | 2-[4-(2-cyanoethylsulfanylmethyl)-(2,4-13C2)1,3-thiazol-2-yl](13C)guanidine |
| InChIKey | FSKYYRZENXOYAP-TTXLGWKISA-N |
| SMILES | C1=[13C](N=[13C](S1)N=[13C](N)N)CSCCC#N |
Computed by PubChem (NCBI)