Products 1185079-36-0

CAS 1185079-36-0 is the registry number for 2,3-Dihydro-5-benzofuranethanol-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.

Structural formula: {0} (CAS {1})

1,1,2,2-tetradeuterio-2-(2,3-dihydro-1-benzofuran-5-yl)ethanol (CAS 1185079-36-0) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 168.23 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(2,3-dihydro-1-benzofuran-5-yl)ethanol. InChIKey: IPSIYKHOHYJGMO-JAJFWILCSA-N.

Identity
Molecular formulaC10H12O2
Molecular weight168.23 g/mol
IUPAC name1,1,2,2-tetradeuterio-2-(2,3-dihydro-1-benzofuran-5-yl)ethanol
InChIKeyIPSIYKHOHYJGMO-JAJFWILCSA-N
SMILES[2H]C([2H])(C1=CC2=C(C=C1)OCC2)C([2H])([2H])O

Computed by PubChem (NCBI)