CAS 1185079-36-0 is the registry number for 2,3-Dihydro-5-benzofuranethanol-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
1,1,2,2-tetradeuterio-2-(2,3-dihydro-1-benzofuran-5-yl)ethanol (CAS 1185079-36-0) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 168.23 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(2,3-dihydro-1-benzofuran-5-yl)ethanol. InChIKey: IPSIYKHOHYJGMO-JAJFWILCSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 168.23 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(2,3-dihydro-1-benzofuran-5-yl)ethanol |
| InChIKey | IPSIYKHOHYJGMO-JAJFWILCSA-N |
| SMILES | [2H]C([2H])(C1=CC2=C(C=C1)OCC2)C([2H])([2H])O |
Computed by PubChem (NCBI)