CAS 1185102-91-3 is the registry number for 2-Methylnaphthalene-13C11. Offered by: TRC. Available pack sizes: 25mg.
2-(113C)methylnaphthalene (CAS 1185102-91-3) is a chemical compound with the molecular formula C11H10 and a molecular weight of 153.117 g/mol. IUPAC name: 2-(113C)methylnaphthalene. InChIKey: QIMMUPPBPVKWKM-ODZTYCMJSA-N.
| Molecular formula | C11H10 |
|---|---|
| Molecular weight | 153.117 g/mol |
| IUPAC name | 2-(113C)methylnaphthalene |
| InChIKey | QIMMUPPBPVKWKM-ODZTYCMJSA-N |
| SMILES | [13CH3][13C]1=[13CH][13C]2=[13CH][13CH]=[13CH][13CH]=[13C]2[13CH]=[13CH]1 |
Computed by PubChem (NCBI)