CAS 1185103-36-9 appears in our catalog under these names: 3-(N-Methyl-N-pentyl-amino)propionitrile-d3, 3-((Methyl-d3)(pentyl)amino)propanenitrile. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
3-[pentyl(trideuteriomethyl)amino]propanenitrile (CAS 1185103-36-9) is a chemical compound with the molecular formula C9H18N2 and a molecular weight of 157.27 g/mol. IUPAC name: 3-[pentyl(trideuteriomethyl)amino]propanenitrile. InChIKey: WCYOUTNXDJQKJM-BMSJAHLVSA-N.
| Molecular formula | C9H18N2 |
|---|---|
| Molecular weight | 157.27 g/mol |
| IUPAC name | 3-[pentyl(trideuteriomethyl)amino]propanenitrile |
| InChIKey | WCYOUTNXDJQKJM-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N(CCCCC)CCC#N |
Computed by PubChem (NCBI)