Products 1185109-79-8
CAS 1185109-79-8 appears in our catalog under these names: Octhilinone-d17, >95% (HPLC), Octhilinone-d17 (1.0 mg/mL in Methanol), Octhilinone-d17. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 1x1ml, 5mg, 25mg, 50mg, 1 mg.
2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)-1,2-thiazol-3-one (CAS 1185109-79-8) is a chemical compound with the molecular formula C11H19NOS and a molecular weight of 230.45 g/mol. IUPAC name: 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)-1,2-thiazol-3-one. InChIKey: JPMIIZHYYWMHDT-SPDJNGSGSA-N.
| Molecular formula | C11H19NOS |
|---|---|
| Molecular weight | 230.45 g/mol |
| IUPAC name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)-1,2-thiazol-3-one |
| InChIKey | JPMIIZHYYWMHDT-SPDJNGSGSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N1C(=O)C=CS1 |
Computed by PubChem (NCBI)