Products 1185155-54-7
CAS 1185155-54-7 appears in our catalog under these names: Fenitrooxon-d6 (O,O-dimethyl-d6), 99 atom % D, min 95% Chemical Purity, Fenitrooxon-d6, Fenitrothion oxon-d6. Offered by: CDN, Biosynth, MedChemExpress. Available pack sizes: 0,01g, 10mg, 5mg, 25mg, 50mg, 1 mg.
(3-methyl-4-nitrophenyl) bis(trideuteriomethyl) phosphate (CAS 1185155-54-7) is a chemical compound with the molecular formula C9H12NO6P and a molecular weight of 267.20 g/mol. IUPAC name: (3-methyl-4-nitrophenyl) bis(trideuteriomethyl) phosphate. InChIKey: MJNAIAPNXYJWCT-XERRXZQWSA-N.
| Molecular formula | C9H12NO6P |
|---|---|
| Molecular weight | 267.20 g/mol |
| IUPAC name | (3-methyl-4-nitrophenyl) bis(trideuteriomethyl) phosphate |
| InChIKey | MJNAIAPNXYJWCT-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])OP(=O)(OC1=CC(=C(C=C1)[N+](=O)[O-])C)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Fenitrooxon-d6, (3-methyl-4-nitrophenyl) bis(trideuteriomethyl) phosphate, Fenitrothion oxon-d6, Fenitrooxon-d6 (O,O-dimethyl-d6), Fenitrothion-oxon D6 (O,O-dimethyl D6); Fenitrooxon-d6, Bis[(2H3)methyl] 3-methyl-4-nitrophenyl phosphate, Bis[(~2~H_3_)methyl] 3-methyl-4-nitrophenyl phosphate