Products 1185157-59-8
CAS 1185157-59-8 is the registry number for Opaganib (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-chlorophenyl)-N-(pyridin-4-ylmethyl)adamantane-1-carboxamide;hydrochloride (CAS 1185157-59-8) is a chemical compound with the molecular formula C23H26Cl2N2O and a molecular weight of 417.4 g/mol. IUPAC name: 3-(4-chlorophenyl)-N-(pyridin-4-ylmethyl)adamantane-1-carboxamide;hydrochloride. InChIKey: BXGLNXNRKRUYTH-UHFFFAOYSA-N.
| Molecular formula | C23H26Cl2N2O |
|---|---|
| Molecular weight | 417.4 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-N-(pyridin-4-ylmethyl)adamantane-1-carboxamide;hydrochloride |
| InChIKey | BXGLNXNRKRUYTH-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)C(=O)NCC4=CC=NC=C4)C5=CC=C(C=C5)Cl.Cl |
Computed by PubChem (NCBI)