CAS 1185158-29-5 appears in our catalog under these names: 5–Bromo–2–(4–nitrophenoxy)pyrimidine, 5-Bromo-2-(4-nitrophenoxy)pyrimidine 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 5g.
5-bromo-2-(4-nitrophenoxy)pyrimidine (CAS 1185158-29-5) is a chemical compound with the molecular formula C10H6BrN3O3 and a molecular weight of 296.08 g/mol. IUPAC name: 5-bromo-2-(4-nitrophenoxy)pyrimidine. InChIKey: JNHTWWLXXMPNNQ-UHFFFAOYSA-N.
| Molecular formula | C10H6BrN3O3 |
|---|---|
| Molecular weight | 296.08 g/mol |
| IUPAC name | 5-bromo-2-(4-nitrophenoxy)pyrimidine |
| InChIKey | JNHTWWLXXMPNNQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)