CAS 1185158-60-4 appears in our catalog under these names: Carfentanil-d5 (1mg/ml in Methanol), Carfentanil-d5. Offered by: TRC. Available pack sizes: 1x1ml, 10mg, 1mg.
Methyl 1-[2-(2,3,4,5,6-pentadeuteriophenyl)ethyl]-4-(N-propanoylanilino)piperidine-4-carboxylate (CAS 1185158-60-4) is a chemical compound with the molecular formula C24H30N2O3 and a molecular weight of 399.5 g/mol. IUPAC name: methyl 1-[2-(2,3,4,5,6-pentadeuteriophenyl)ethyl]-4-(N-propanoylanilino)piperidine-4-carboxylate. InChIKey: YDSDEBIZUNNPOB-BGCGZSDZSA-N.
| Molecular formula | C24H30N2O3 |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | methyl 1-[2-(2,3,4,5,6-pentadeuteriophenyl)ethyl]-4-(N-propanoylanilino)piperidine-4-carboxylate |
| InChIKey | YDSDEBIZUNNPOB-BGCGZSDZSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CCN2CCC(CC2)(C(=O)OC)N(C3=CC=CC=C3)C(=O)CC)[2H])[2H] |
Computed by PubChem (NCBI)