Products 1185162-28-0
CAS 1185162-28-0 is the registry number for 5-Amino-1-tert-butyl-3-(3-methylbenzyl)-4-cyanopyrazole. Offered by: TRC. Available pack sizes: 200mg, 20mg.
5-amino-1-tert-butyl-3-[(3-methylphenyl)methyl]pyrazole-4-carbonitrile (CAS 1185162-28-0) is a chemical compound with the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. IUPAC name: 5-amino-1-tert-butyl-3-[(3-methylphenyl)methyl]pyrazole-4-carbonitrile. InChIKey: QMVSXFKVXNGFAZ-UHFFFAOYSA-N.
| Molecular formula | C16H20N4 |
|---|---|
| Molecular weight | 268.36 g/mol |
| IUPAC name | 5-amino-1-tert-butyl-3-[(3-methylphenyl)methyl]pyrazole-4-carbonitrile |
| InChIKey | QMVSXFKVXNGFAZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CC2=NN(C(=C2C#N)N)C(C)(C)C |
Computed by PubChem (NCBI)