Products 1185174-46-2

CAS 1185174-46-2 is the registry number for Desacetyl Actarit-d4. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 25mg.

Structural formula: {0} (CAS {1})

2-(4-amino-2,3,5,6-tetradeuteriophenyl)acetic acid (CAS 1185174-46-2) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 155.19 g/mol. IUPAC name: 2-(4-amino-2,3,5,6-tetradeuteriophenyl)acetic acid. InChIKey: CSEWAUGPAQPMDC-RHQRLBAQSA-N.

Identity
Molecular formulaC8H9NO2
Molecular weight155.19 g/mol
IUPAC name2-(4-amino-2,3,5,6-tetradeuteriophenyl)acetic acid
InChIKeyCSEWAUGPAQPMDC-RHQRLBAQSA-N
SMILES[2H]C1=C(C(=C(C(=C1CC(=O)O)[2H])[2H])N)[2H]

Computed by PubChem (NCBI)