CAS 1185241-48-8 appears in our catalog under these names: Famotidine-13C3, >95% (HPLC), Famotidine-13C3. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 10 mg, 1 mg.
3-[[2-(diamino(113C)methylideneamino)-(2,4-13C2)1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide (CAS 1185241-48-8) is a chemical compound with the molecular formula C8H15N7O2S3 and a molecular weight of 340.4 g/mol. IUPAC name: 3-[[2-(diamino(113C)methylideneamino)-(2,4-13C2)1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide. InChIKey: XUFQPHANEAPEMJ-QIOHBQFSSA-N.
| Molecular formula | C8H15N7O2S3 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 3-[[2-(diamino(113C)methylideneamino)-(2,4-13C2)1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide |
| InChIKey | XUFQPHANEAPEMJ-QIOHBQFSSA-N |
| SMILES | C1=[13C](N=[13C](S1)N=[13C](N)N)CSCCC(=NS(=O)(=O)N)N |
Computed by PubChem (NCBI)