CAS 1185243-70-2 appears in our catalog under these names: Eprosartan-d3, >95% (HPLC), Eprosartan-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
4-[[5-[(E)-2-carboxy-3-thiophen-2-ylprop-1-enyl]-2-(4,4,4-trideuteriobutyl)imidazol-1-yl]methyl]benzoic acid (CAS 1185243-70-2) is a chemical compound with the molecular formula C23H24N2O4S and a molecular weight of 427.5 g/mol. IUPAC name: 4-[[5-[(E)-2-carboxy-3-thiophen-2-ylprop-1-enyl]-2-(4,4,4-trideuteriobutyl)imidazol-1-yl]methyl]benzoic acid. InChIKey: OROAFUQRIXKEMV-FDKNJLTISA-N.
| Molecular formula | C23H24N2O4S |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | 4-[[5-[(E)-2-carboxy-3-thiophen-2-ylprop-1-enyl]-2-(4,4,4-trideuteriobutyl)imidazol-1-yl]methyl]benzoic acid |
| InChIKey | OROAFUQRIXKEMV-FDKNJLTISA-N |
| SMILES | [2H]C([2H])([2H])CCCC1=NC=C(N1CC2=CC=C(C=C2)C(=O)O)/C=C(\CC3=CC=CS3)/C(=O)O |
Computed by PubChem (NCBI)