Products 1185282-03-4
CAS 1185282-03-4 appears in our catalog under these names: APP-FUBINACA RM, APP–FUBINACA, APP-FUBINACA. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 50mg, 1 mg, 25 mg, 10 mg, 50 mg.
N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-[(4-fluorophenyl)methyl]indazole-3-carboxamide (CAS 1185282-03-4) is a chemical compound with the molecular formula C24H21FN4O2 and a molecular weight of 416.4 g/mol. IUPAC name: N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-[(4-fluorophenyl)methyl]indazole-3-carboxamide. InChIKey: TZXBEYFALIFOAG-FQEVSTJZSA-N.
| Molecular formula | C24H21FN4O2 |
|---|---|
| Molecular weight | 416.4 g/mol |
| IUPAC name | N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-[(4-fluorophenyl)methyl]indazole-3-carboxamide |
| InChIKey | TZXBEYFALIFOAG-FQEVSTJZSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N)NC(=O)C2=NN(C3=CC=CC=C32)CC4=CC=C(C=C4)F |
Computed by PubChem (NCBI)