CAS 1185287-50-6 appears in our catalog under these names: Methyl 1–(4–fluorobenzyl)–1H–indazole–3–carboxylate, Methyl 1-(4-fluorobenzyl)-1H-indazole-3-carboxylate. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
Methyl 1-[(4-fluorophenyl)methyl]indazole-3-carboxylate (CAS 1185287-50-6) is a chemical compound with the molecular formula C16H13FN2O2 and a molecular weight of 284.28 g/mol. IUPAC name: methyl 1-[(4-fluorophenyl)methyl]indazole-3-carboxylate. InChIKey: UUCUVSWGJOQWCA-UHFFFAOYSA-N.
| Molecular formula | C16H13FN2O2 |
|---|---|
| Molecular weight | 284.28 g/mol |
| IUPAC name | methyl 1-[(4-fluorophenyl)methyl]indazole-3-carboxylate |
| InChIKey | UUCUVSWGJOQWCA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN(C2=CC=CC=C21)CC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)