CAS 1185292-65-2 is the registry number for 1-Phenyl-3-(trifluoromethyl)-1H-pyrazole-4-carbonitrile, 95+%. Offered by: AmBeed. Available pack sizes: 100mg.
1-phenyl-3-(trifluoromethyl)pyrazole-4-carbonitrile (CAS 1185292-65-2) is a chemical compound with the molecular formula C11H6F3N3 and a molecular weight of 237.18 g/mol. IUPAC name: 1-phenyl-3-(trifluoromethyl)pyrazole-4-carbonitrile. InChIKey: LWQJQWADNBQYCP-UHFFFAOYSA-N.
| Molecular formula | C11H6F3N3 |
|---|---|
| Molecular weight | 237.18 g/mol |
| IUPAC name | 1-phenyl-3-(trifluoromethyl)pyrazole-4-carbonitrile |
| InChIKey | LWQJQWADNBQYCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C(=N2)C(F)(F)F)C#N |
Computed by PubChem (NCBI)