CAS 1185293-39-3 is the registry number for N~1~,N~1~-dimethyl-1-(3-methyl-2-thienyl)-1,2-ethanediamine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N,N-dimethyl-1-(3-methylthiophen-2-yl)ethane-1,2-diamine;hydrochloride (CAS 1185293-39-3) is a chemical compound with the molecular formula C9H17ClN2S and a molecular weight of 220.76 g/mol. IUPAC name: N,N-dimethyl-1-(3-methylthiophen-2-yl)ethane-1,2-diamine;hydrochloride. InChIKey: RCXCOPZAWWQVGR-UHFFFAOYSA-N.
| Molecular formula | C9H17ClN2S |
|---|---|
| Molecular weight | 220.76 g/mol |
| IUPAC name | N,N-dimethyl-1-(3-methylthiophen-2-yl)ethane-1,2-diamine;hydrochloride |
| InChIKey | RCXCOPZAWWQVGR-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1)C(CN)N(C)C.Cl |
Computed by PubChem (NCBI)