Products 1185294-81-8

CAS 1185294-81-8 is the registry number for Ethyl 1-methyl-4-oxopiperidine-3-carboxylate oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Ethyl 1-methyl-4-oxopiperidine-3-carboxylate;oxalic acid (CAS 1185294-81-8) is a chemical compound with the molecular formula C11H17NO7 and a molecular weight of 275.25 g/mol. IUPAC name: ethyl 1-methyl-4-oxopiperidine-3-carboxylate;oxalic acid. InChIKey: AVTNHFGVBOTPBI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17NO7
Molecular weight275.25 g/mol
IUPAC nameethyl 1-methyl-4-oxopiperidine-3-carboxylate;oxalic acid
InChIKeyAVTNHFGVBOTPBI-UHFFFAOYSA-N
SMILESCCOC(=O)C1CN(CCC1=O)C.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)