CAS 1185295-44-6 is the registry number for 4-(1-Aminoethyl)-2-fluorophenol hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(1-aminoethyl)-2-fluorophenol;hydrobromide (CAS 1185295-44-6) is a chemical compound with the molecular formula C8H11BrFNO and a molecular weight of 236.08 g/mol. IUPAC name: 4-(1-aminoethyl)-2-fluorophenol;hydrobromide. InChIKey: KCWGDWPPYWJQNW-UHFFFAOYSA-N.
| Molecular formula | C8H11BrFNO |
|---|---|
| Molecular weight | 236.08 g/mol |
| IUPAC name | 4-(1-aminoethyl)-2-fluorophenol;hydrobromide |
| InChIKey | KCWGDWPPYWJQNW-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)O)F)N.Br |
Computed by PubChem (NCBI)