CAS 1185297-12-4 is the registry number for (5-Amino-3-trifluoromethyl-[1,2,4]triazol-1-yl)-acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-[5-amino-3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetic acid;hydrochloride (CAS 1185297-12-4) is a chemical compound with the molecular formula C5H6ClF3N4O2 and a molecular weight of 246.57 g/mol. IUPAC name: 2-[5-amino-3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetic acid;hydrochloride. InChIKey: HWUVMIWZNBADKL-UHFFFAOYSA-N.
| Molecular formula | C5H6ClF3N4O2 |
|---|---|
| Molecular weight | 246.57 g/mol |
| IUPAC name | 2-[5-amino-3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetic acid;hydrochloride |
| InChIKey | HWUVMIWZNBADKL-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)N1C(=NC(=N1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)