Products 1185306-06-2
CAS 1185306-06-2 is the registry number for 1–bromo–4–(ethyl–d5)benzene. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
1-bromo-4-(1,1,2,2,2-pentadeuterioethyl)benzene (CAS 1185306-06-2) is a chemical compound with the molecular formula C8H9Br and a molecular weight of 190.09 g/mol. IUPAC name: 1-bromo-4-(1,1,2,2,2-pentadeuterioethyl)benzene. InChIKey: URFPRAHGGBYNPW-ZBJDZAJPSA-N.
| Molecular formula | C8H9Br |
|---|---|
| Molecular weight | 190.09 g/mol |
| IUPAC name | 1-bromo-4-(1,1,2,2,2-pentadeuterioethyl)benzene |
| InChIKey | URFPRAHGGBYNPW-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)