CAS 1185306-34-6 is the registry number for 4–(Methoxy–d3)–3–fluorobromobenzene. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
4-bromo-2-fluoro-1-(trideuteriomethoxy)benzene (CAS 1185306-34-6) is a chemical compound with the molecular formula C7H6BrFO and a molecular weight of 208.04 g/mol. IUPAC name: 4-bromo-2-fluoro-1-(trideuteriomethoxy)benzene. InChIKey: DWNXGZBXFDNKOR-FIBGUPNXSA-N.
| Molecular formula | C7H6BrFO |
|---|---|
| Molecular weight | 208.04 g/mol |
| IUPAC name | 4-bromo-2-fluoro-1-(trideuteriomethoxy)benzene |
| InChIKey | DWNXGZBXFDNKOR-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)