CAS 1185306-38-0 is the registry number for 2–(Methoxy–d3)–5–fluorobromobenzene. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
2-bromo-4-fluoro-1-(trideuteriomethoxy)benzene (CAS 1185306-38-0) is a chemical compound with the molecular formula C7H6BrFO and a molecular weight of 208.04 g/mol. IUPAC name: 2-bromo-4-fluoro-1-(trideuteriomethoxy)benzene. InChIKey: JIQXVIJARQLCOY-FIBGUPNXSA-N.
| Molecular formula | C7H6BrFO |
|---|---|
| Molecular weight | 208.04 g/mol |
| IUPAC name | 2-bromo-4-fluoro-1-(trideuteriomethoxy)benzene |
| InChIKey | JIQXVIJARQLCOY-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)F)Br |
Computed by PubChem (NCBI)