Products 1185306-54-0
CAS 1185306-54-0 is the registry number for 4–Chloro–2–amino–6–(methyl–d3)–pyrimidine. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
4-chloro-6-(trideuteriomethyl)pyrimidin-2-amine (CAS 1185306-54-0) is a chemical compound with the molecular formula C5H6ClN3 and a molecular weight of 146.59 g/mol. IUPAC name: 4-chloro-6-(trideuteriomethyl)pyrimidin-2-amine. InChIKey: NPTGVVKPLWFPPX-FIBGUPNXSA-N.
| Molecular formula | C5H6ClN3 |
|---|---|
| Molecular weight | 146.59 g/mol |
| IUPAC name | 4-chloro-6-(trideuteriomethyl)pyrimidin-2-amine |
| InChIKey | NPTGVVKPLWFPPX-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=NC(=N1)N)Cl |
Computed by PubChem (NCBI)