Products 1185306-56-2
CAS 1185306-56-2 is the registry number for 1–bromo–2，3–bis(methyl–d3)benzene. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
1-bromo-2,3-bis(trideuteriomethyl)benzene (CAS 1185306-56-2) is a chemical compound with the molecular formula C8H9Br and a molecular weight of 191.10 g/mol. IUPAC name: 1-bromo-2,3-bis(trideuteriomethyl)benzene. InChIKey: WLPXNBYWDDYJTN-WFGJKAKNSA-N.
| Molecular formula | C8H9Br |
|---|---|
| Molecular weight | 191.10 g/mol |
| IUPAC name | 1-bromo-2,3-bis(trideuteriomethyl)benzene |
| InChIKey | WLPXNBYWDDYJTN-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=CC=C1)Br)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)