CAS 1185306-59-5 is the registry number for 3–Chloro–4–methyl–6–(methyl–d3)–pyridazine. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
3-chloro-4-methyl-6-(trideuteriomethyl)pyridazine (CAS 1185306-59-5) is a chemical compound with the molecular formula C6H7ClN2 and a molecular weight of 145.60 g/mol. IUPAC name: 3-chloro-4-methyl-6-(trideuteriomethyl)pyridazine. InChIKey: CIBIWQSBPWNHNJ-BMSJAHLVSA-N.
| Molecular formula | C6H7ClN2 |
|---|---|
| Molecular weight | 145.60 g/mol |
| IUPAC name | 3-chloro-4-methyl-6-(trideuteriomethyl)pyridazine |
| InChIKey | CIBIWQSBPWNHNJ-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])C1=NN=C(C(=C1)C)Cl |
Computed by PubChem (NCBI)