CAS 1185306-70-0 is the registry number for 4–Bromo–3,5–(dimethyl–d6)–isoxazole. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
4-bromo-3,5-bis(trideuteriomethyl)-1,2-oxazole (CAS 1185306-70-0) is a chemical compound with the molecular formula C5H6BrNO and a molecular weight of 182.05 g/mol. IUPAC name: 4-bromo-3,5-bis(trideuteriomethyl)-1,2-oxazole. InChIKey: GYHZPSUAMYIFQD-WFGJKAKNSA-N.
| Molecular formula | C5H6BrNO |
|---|---|
| Molecular weight | 182.05 g/mol |
| IUPAC name | 4-bromo-3,5-bis(trideuteriomethyl)-1,2-oxazole |
| InChIKey | GYHZPSUAMYIFQD-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=NO1)C([2H])([2H])[2H])Br |
Computed by PubChem (NCBI)