CAS 1185306-75-5 is the registry number for 6–Bromo–2–(methyl–d3)–benzothiazole. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
6-bromo-2-(trideuteriomethyl)-1,3-benzothiazole (CAS 1185306-75-5) is a chemical compound with the molecular formula C8H6BrNS and a molecular weight of 231.13 g/mol. IUPAC name: 6-bromo-2-(trideuteriomethyl)-1,3-benzothiazole. InChIKey: NPBQNFVPWXRIGG-FIBGUPNXSA-N.
| Molecular formula | C8H6BrNS |
|---|---|
| Molecular weight | 231.13 g/mol |
| IUPAC name | 6-bromo-2-(trideuteriomethyl)-1,3-benzothiazole |
| InChIKey | NPBQNFVPWXRIGG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC2=C(S1)C=C(C=C2)Br |
Computed by PubChem (NCBI)