CAS 1185306-83-5 is the registry number for 2–Amino–4–(ethyl–d5)–thiazole. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
4-(1,1,2,2,2-pentadeuterioethyl)-1,3-thiazol-2-amine (CAS 1185306-83-5) is a chemical compound with the molecular formula C5H8N2S and a molecular weight of 133.23 g/mol. IUPAC name: 4-(1,1,2,2,2-pentadeuterioethyl)-1,3-thiazol-2-amine. InChIKey: JJDSGHBAXFTEHZ-ZBJDZAJPSA-N.
| Molecular formula | C5H8N2S |
|---|---|
| Molecular weight | 133.23 g/mol |
| IUPAC name | 4-(1,1,2,2,2-pentadeuterioethyl)-1,3-thiazol-2-amine |
| InChIKey | JJDSGHBAXFTEHZ-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=CSC(=N1)N |
Computed by PubChem (NCBI)